C22H32N4O3S — CID 135890538
3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(1-piperidin-1-ylcyclohexyl)methyl]propanamide (PubChem CID 135890538) has the molecular formula C22H32N4O3S and a molecular weight of 432.59 g/mol. Its IUPAC name is 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(1-piperidin-1-ylcyclohexyl)methyl]propanamide.
| Compound Name | 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(1-piperidin-1-ylcyclohexyl)methyl]propanamide |
|---|---|
| PubChem CID | 135890538 |
| Molecular Formula | C22H32N4O3S |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(1-piperidin-1-ylcyclohexyl)methyl]propanamide |
| SMILES | O=C(CC/N=C1\NS(=O)(=O)c2ccccc21)NCC1(N2CCCCC2)CCCCC1 |
| InChI | InChI=1S/C22H32N4O3S/c27-20(11-14-23-21-18-9-3-4-10-19(18)30(28,29)25-21)24-17-22(12-5-1-6-13-22)26-15-7-2-8-16-26/h3-4,9-10H,1-2,5-8,11-17H2,(H,23,25)(H,24,27) |
| InChIKey | WCHSHOFXRWTREB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|