C27H29FN6O7 — CID 135891271
(4S,12aS)-4,7-bis(dimethylamino)-9-[(5-fluoropyrazin-2-yl)amino]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 135891271) has the molecular formula C27H29FN6O7 and a molecular weight of 568.56 g/mol. Its IUPAC name is (4S,12aS)-4,7-bis(dimethylamino)-9-[(5-fluoropyrazin-2-yl)amino]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,12aS)-4,7-bis(dimethylamino)-9-[(5-fluoropyrazin-2-yl)amino]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 135891271 |
| Molecular Formula | C27H29FN6O7 |
| Molecular Weight | 568.56 g/mol |
| Exact Mass | 568.21 |
| IUPAC Name | (4S,12aS)-4,7-bis(dimethylamino)-9-[(5-fluoropyrazin-2-yl)amino]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)c1cc(Nc2cnc(F)cn2)c(O)c2c1CC1CC3[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C27H29FN6O7/c1-33(2)14-7-13(32-16-9-30-15(28)8-31-16)21(35)18-11(14)5-10-6-12-20(34(3)4)23(37)19(26(29)40)25(39)27(12,41)24(38)17(10)22(18)36/h7-10,12,17,19-20,35,41H,5-6H2,1-4H3,(H2,29,40)(H,31,32)/t10?,12?,17?,19?,20-,27-/m0/s1 |
| InChIKey | MZZZAYWSMXROLW-QLEKXBEASA-N |
| XLogP | -0.39 |
| TPSA | 196.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.56 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|