About 6-hydroxy-5-(2-oxoindol-3-yl)-1H-pyrimidine-2,4-dione;hydrate
6-hydroxy-5-(2-oxoindol-3-yl)-1H-pyrimidine-2,4-dione;hydrate (PubChem CID 135891515) has the molecular formula C12H9N3O5
and a molecular weight of 275.22 g/mol. Its IUPAC name is 6-hydroxy-5-(2-oxoindol-3-yl)-1H-pyrimidine-2,4-dione;hydrate.
Molecular Properties
| Compound Name | 6-hydroxy-5-(2-oxoindol-3-yl)-1H-pyrimidine-2,4-dione;hydrate |
| PubChem CID | 135891515 |
| Molecular Formula | C12H9N3O5 |
| Molecular Weight | 275.22 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 6-hydroxy-5-(2-oxoindol-3-yl)-1H-pyrimidine-2,4-dione;hydrate |
| SMILES | O.O=C1N=c2ccccc2=C1c1c(O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H7N3O4.H2O/c16-9-7(5-3-1-2-4-6(5)13-9)8-10(17)14-12(19)15-11(8)18;/h1-4H,(H3,14,15,17,18,19);1H2 |
| InChIKey | DNQPULPQMHNDNL-UHFFFAOYSA-N |
| XLogP | -2.70 |
| TPSA | 146.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.22 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-hydroxy-5-(2-oxoindol-3-yl)-1H-pyrimidine-2,4-dione;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-5-(2-oxoindol-3-yl)-1H-pyrimidine-2,4-dione;hydrate?
The IUPAC name of 6-hydroxy-5-(2-oxoindol-3-yl)-1H-pyrimidine-2,4-dione;hydrate (CID 135891515) is 6-hydroxy-5-(2-oxoindol-3-yl)-1H-pyrimidine-2,4-dione;hydrate.
What is the SMILES notation for 6-hydroxy-5-(2-oxoindol-3-yl)-1H-pyrimidine-2,4-dione;hydrate?
The canonical SMILES for 6-hydroxy-5-(2-oxoindol-3-yl)-1H-pyrimidine-2,4-dione;hydrate is O.O=C1N=c2ccccc2=C1c1c(O)[nH]c(=O)[nH]c1=O.
What is the InChIKey of 6-hydroxy-5-(2-oxoindol-3-yl)-1H-pyrimidine-2,4-dione;hydrate?
The InChIKey is DNQPULPQMHNDNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7N3O4.H2O/c16-9-7(5-3-1-2-4-6(5)13-9)8-10(17)14-12(19)15-11(8)18;/h1-4H,(H3,14,15,17,18,19);1H2.
What are the key properties of 6-hydroxy-5-(2-oxoindol-3-yl)-1H-pyrimidine-2,4-dione;hydrate?
6-hydroxy-5-(2-oxoindol-3-yl)-1H-pyrimidine-2,4-dione;hydrate has a molecular weight of 275.22 g/mol, XLogP of -2.70, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-5-(2-oxoindol-3-yl)-1H-pyrimidine-2,4-dione;hydrate is sourced from PubChem (CID 135891515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).