C14H16F3N2O4P — CID 135891668
3-[(1R)-1-diethoxyphosphoryl-2,2,2-trifluoroethyl]imino-1H-indol-2-one (PubChem CID 135891668) has the molecular formula C14H16F3N2O4P and a molecular weight of 364.26 g/mol. Its IUPAC name is 3-[(1R)-1-diethoxyphosphoryl-2,2,2-trifluoroethyl]imino-1H-indol-2-one.
| Compound Name | 3-[(1R)-1-diethoxyphosphoryl-2,2,2-trifluoroethyl]imino-1H-indol-2-one |
|---|---|
| PubChem CID | 135891668 |
| Molecular Formula | C14H16F3N2O4P |
| Molecular Weight | 364.26 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | 3-[(1R)-1-diethoxyphosphoryl-2,2,2-trifluoroethyl]imino-1H-indol-2-one |
| SMILES | CCOP(=O)(OCC)[C@@H](N=C1C(=O)Nc2ccccc21)C(F)(F)F |
| InChI | InChI=1S/C14H16F3N2O4P/c1-3-22-24(21,23-4-2)13(14(15,16)17)19-11-9-7-5-6-8-10(9)18-12(11)20/h5-8,13H,3-4H2,1-2H3,(H,18,19,20)/t13-/m1/s1 |
| InChIKey | JJWHCDKBXZINDL-CYBMUJFWSA-N |
| XLogP | 3.58 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.26 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|