C17H25N5O3 — CID 135892780
3-[1-(4,5-dimethyl-6-oxo-1H-pyrimidin-2-yl)-3,5-dimethylpyrazol-4-yl]-N-(2-methoxyethyl)propanamide (PubChem CID 135892780) has the molecular formula C17H25N5O3 and a molecular weight of 347.42 g/mol. Its IUPAC name is 3-[1-(4,5-dimethyl-6-oxo-1H-pyrimidin-2-yl)-3,5-dimethylpyrazol-4-yl]-N-(2-methoxyethyl)propanamide.
| Compound Name | 3-[1-(4,5-dimethyl-6-oxo-1H-pyrimidin-2-yl)-3,5-dimethylpyrazol-4-yl]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 135892780 |
| Molecular Formula | C17H25N5O3 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 3-[1-(4,5-dimethyl-6-oxo-1H-pyrimidin-2-yl)-3,5-dimethylpyrazol-4-yl]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)CCc1c(C)nn(-c2nc(C)c(C)c(=O)[nH]2)c1C |
| InChI | InChI=1S/C17H25N5O3/c1-10-11(2)19-17(20-16(10)24)22-13(4)14(12(3)21-22)6-7-15(23)18-8-9-25-5/h6-9H2,1-5H3,(H,18,23)(H,19,20,24) |
| InChIKey | NRIUWMWIEKPQHM-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|