About 2-[[(E)-1,3-dipyridin-2-ylbut-2-enylidene]amino]phenol
2-[[(E)-1,3-dipyridin-2-ylbut-2-enylidene]amino]phenol (PubChem CID 135893022) has the molecular formula C20H17N3O
and a molecular weight of 315.38 g/mol. Its IUPAC name is 2-[[(E)-1,3-dipyridin-2-ylbut-2-enylidene]amino]phenol.
Molecular Properties
| Compound Name | 2-[[(E)-1,3-dipyridin-2-ylbut-2-enylidene]amino]phenol |
| PubChem CID | 135893022 |
| Molecular Formula | C20H17N3O |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 2-[[(E)-1,3-dipyridin-2-ylbut-2-enylidene]amino]phenol |
| SMILES | C/C(=C\C(=N/c1ccccc1O)c1ccccn1)c1ccccn1 |
| InChI | InChI=1S/C20H17N3O/c1-15(16-8-4-6-12-21-16)14-19(17-9-5-7-13-22-17)23-18-10-2-3-11-20(18)24/h2-14,24H,1H3/b15-14+,23-19+ |
| InChIKey | KPOKXRVLYZFJDR-JROXYKORSA-N |
| XLogP | 4.41 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(E)-1,3-dipyridin-2-ylbut-2-enylidene]amino]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(E)-1,3-dipyridin-2-ylbut-2-enylidene]amino]phenol?
The IUPAC name of 2-[[(E)-1,3-dipyridin-2-ylbut-2-enylidene]amino]phenol (CID 135893022) is 2-[[(E)-1,3-dipyridin-2-ylbut-2-enylidene]amino]phenol.
What is the SMILES notation for 2-[[(E)-1,3-dipyridin-2-ylbut-2-enylidene]amino]phenol?
The canonical SMILES for 2-[[(E)-1,3-dipyridin-2-ylbut-2-enylidene]amino]phenol is C/C(=C\C(=N/c1ccccc1O)c1ccccn1)c1ccccn1.
What is the InChIKey of 2-[[(E)-1,3-dipyridin-2-ylbut-2-enylidene]amino]phenol?
The InChIKey is KPOKXRVLYZFJDR-JROXYKORSA-N. The full InChI is InChI=1S/C20H17N3O/c1-15(16-8-4-6-12-21-16)14-19(17-9-5-7-13-22-17)23-18-10-2-3-11-20(18)24/h2-14,24H,1H3/b15-14+,23-19+.
What are the key properties of 2-[[(E)-1,3-dipyridin-2-ylbut-2-enylidene]amino]phenol?
2-[[(E)-1,3-dipyridin-2-ylbut-2-enylidene]amino]phenol has a molecular weight of 315.38 g/mol, XLogP of 4.41, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(E)-1,3-dipyridin-2-ylbut-2-enylidene]amino]phenol is sourced from PubChem (CID 135893022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).