C19H20N4O4S — CID 135893474
3-(4-oxo-3H-quinazolin-2-yl)-N-[1-(4-sulfamoylphenyl)ethyl]propanamide (PubChem CID 135893474) has the molecular formula C19H20N4O4S and a molecular weight of 400.46 g/mol. Its IUPAC name is 3-(4-oxo-3H-quinazolin-2-yl)-N-[1-(4-sulfamoylphenyl)ethyl]propanamide.
| Compound Name | 3-(4-oxo-3H-quinazolin-2-yl)-N-[1-(4-sulfamoylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 135893474 |
| Molecular Formula | C19H20N4O4S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 3-(4-oxo-3H-quinazolin-2-yl)-N-[1-(4-sulfamoylphenyl)ethyl]propanamide |
| SMILES | CC(NC(=O)CCc1nc2ccccc2c(=O)[nH]1)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C19H20N4O4S/c1-12(13-6-8-14(9-7-13)28(20,26)27)21-18(24)11-10-17-22-16-5-3-2-4-15(16)19(25)23-17/h2-9,12H,10-11H2,1H3,(H,21,24)(H2,20,26,27)(H,22,23,25) |
| InChIKey | HHRFLQNTWASYFZ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 135.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |