C8H6N2O2 — CID 135894470
3-hydroxy-1H-1,5-naphthyridin-2-one (PubChem CID 135894470) has the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. Its IUPAC name is 3-hydroxy-1H-1,5-naphthyridin-2-one.
| Compound Name | 3-hydroxy-1H-1,5-naphthyridin-2-one |
|---|---|
| PubChem CID | 135894470 |
| Molecular Formula | C8H6N2O2 |
| Molecular Weight | 162.15 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | 3-hydroxy-1H-1,5-naphthyridin-2-one |
| SMILES | O=c1[nH]c2cccnc2cc1O |
| InChI | InChI=1S/C8H6N2O2/c11-7-4-6-5(10-8(7)12)2-1-3-9-6/h1-4,11H,(H,10,12) |
| InChIKey | JVZDRGNZYCOVSZ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.15 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |