C14H22N2OS2 — CID 135895122
5-[[(1S,2S,3R)-2,3-dimethylcyclohexyl]iminomethyl]-3-ethyl-4-hydroxy-1,3-thiazole-2-thione (PubChem CID 135895122) has the molecular formula C14H22N2OS2 and a molecular weight of 298.48 g/mol. Its IUPAC name is 5-[[(1S,2S,3R)-2,3-dimethylcyclohexyl]iminomethyl]-3-ethyl-4-hydroxy-1,3-thiazole-2-thione.
| Compound Name | 5-[[(1S,2S,3R)-2,3-dimethylcyclohexyl]iminomethyl]-3-ethyl-4-hydroxy-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 135895122 |
| Molecular Formula | C14H22N2OS2 |
| Molecular Weight | 298.48 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 5-[[(1S,2S,3R)-2,3-dimethylcyclohexyl]iminomethyl]-3-ethyl-4-hydroxy-1,3-thiazole-2-thione |
| SMILES | CCn1c(O)c(/C=N/[C@H]2CCC[C@@H](C)[C@@H]2C)sc1=S |
| InChI | InChI=1S/C14H22N2OS2/c1-4-16-13(17)12(19-14(16)18)8-15-11-7-5-6-9(2)10(11)3/h8-11,17H,4-7H2,1-3H3/b15-8+/t9-,10+,11+/m1/s1 |
| InChIKey | RNSOBCIFXZCEPX-CQHPTWDDSA-N |
| XLogP | 4.25 |
| TPSA | 37.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|