About 2-[3-[(3,5-dibromophenyl)methylamino]propylamino]-3H-quinazolin-4-one
2-[3-[(3,5-dibromophenyl)methylamino]propylamino]-3H-quinazolin-4-one (PubChem CID 135895154) has the molecular formula C18H18Br2N4O
and a molecular weight of 466.18 g/mol. Its IUPAC name is 2-[3-[(3,5-dibromophenyl)methylamino]propylamino]-3H-quinazolin-4-one.
Molecular Properties
| Compound Name | 2-[3-[(3,5-dibromophenyl)methylamino]propylamino]-3H-quinazolin-4-one |
| PubChem CID | 135895154 |
| Molecular Formula | C18H18Br2N4O |
| Molecular Weight | 466.18 g/mol |
| Exact Mass | 463.98 |
| IUPAC Name | 2-[3-[(3,5-dibromophenyl)methylamino]propylamino]-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(NCCCNCc2cc(Br)cc(Br)c2)nc2ccccc12 |
| InChI | InChI=1S/C18H18Br2N4O/c19-13-8-12(9-14(20)10-13)11-21-6-3-7-22-18-23-16-5-2-1-4-15(16)17(25)24-18/h1-2,4-5,8-10,21H,3,6-7,11H2,(H2,22,23,24,25) |
| InChIKey | RPJDZINHBYUYQN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.18 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-[(3,5-dibromophenyl)methylamino]propylamino]-3H-quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[(3,5-dibromophenyl)methylamino]propylamino]-3H-quinazolin-4-one?
The IUPAC name of 2-[3-[(3,5-dibromophenyl)methylamino]propylamino]-3H-quinazolin-4-one (CID 135895154) is 2-[3-[(3,5-dibromophenyl)methylamino]propylamino]-3H-quinazolin-4-one.
What is the SMILES notation for 2-[3-[(3,5-dibromophenyl)methylamino]propylamino]-3H-quinazolin-4-one?
The canonical SMILES for 2-[3-[(3,5-dibromophenyl)methylamino]propylamino]-3H-quinazolin-4-one is O=c1[nH]c(NCCCNCc2cc(Br)cc(Br)c2)nc2ccccc12.
What is the InChIKey of 2-[3-[(3,5-dibromophenyl)methylamino]propylamino]-3H-quinazolin-4-one?
The InChIKey is RPJDZINHBYUYQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18Br2N4O/c19-13-8-12(9-14(20)10-13)11-21-6-3-7-22-18-23-16-5-2-1-4-15(16)17(25)24-18/h1-2,4-5,8-10,21H,3,6-7,11H2,(H2,22,23,24,25).
What are the key properties of 2-[3-[(3,5-dibromophenyl)methylamino]propylamino]-3H-quinazolin-4-one?
2-[3-[(3,5-dibromophenyl)methylamino]propylamino]-3H-quinazolin-4-one has a molecular weight of 466.18 g/mol, XLogP of 4.04, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[(3,5-dibromophenyl)methylamino]propylamino]-3H-quinazolin-4-one is sourced from PubChem (CID 135895154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).