C24H26N4OS — CID 135895192
2-[4-(4-phenylpiperazin-1-yl)butyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one (PubChem CID 135895192) has the molecular formula C24H26N4OS and a molecular weight of 418.57 g/mol. Its IUPAC name is 2-[4-(4-phenylpiperazin-1-yl)butyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one.
| Compound Name | 2-[4-(4-phenylpiperazin-1-yl)butyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135895192 |
| Molecular Formula | C24H26N4OS |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 2-[4-(4-phenylpiperazin-1-yl)butyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(CCCCN2CCN(c3ccccc3)CC2)nc2c1sc1ccccc12 |
| InChI | InChI=1S/C24H26N4OS/c29-24-23-22(19-10-4-5-11-20(19)30-23)25-21(26-24)12-6-7-13-27-14-16-28(17-15-27)18-8-2-1-3-9-18/h1-5,8-11H,6-7,12-17H2,(H,25,26,29) |
| InChIKey | FRXYUSBARUFRNO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|