C12H15ClFN7O4S — CID 135895380
N'-(3-chloro-4-fluorophenyl)-N-hydroxy-4-[3-(sulfamoylamino)propylamino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 135895380) has the molecular formula C12H15ClFN7O4S and a molecular weight of 407.82 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-N-hydroxy-4-[3-(sulfamoylamino)propylamino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-N-hydroxy-4-[3-(sulfamoylamino)propylamino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 135895380 |
| Molecular Formula | C12H15ClFN7O4S |
| Molecular Weight | 407.82 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-N-hydroxy-4-[3-(sulfamoylamino)propylamino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | NS(=O)(=O)NCCCNc1nonc1/C(=N/c1ccc(F)c(Cl)c1)NO |
| InChI | InChI=1S/C12H15ClFN7O4S/c13-8-6-7(2-3-9(8)14)18-12(19-22)10-11(21-25-20-10)16-4-1-5-17-26(15,23)24/h2-3,6,17,22H,1,4-5H2,(H,16,21)(H,18,19)(H2,15,23,24) |
| InChIKey | GEEKZOQCGSPGBL-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 167.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.82 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|