C14H17F3N6O4S — CID 135895391
N-hydroxy-4-[3-(methanesulfonamido)propylamino]-N'-[3-(trifluoromethyl)phenyl]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 135895391) has the molecular formula C14H17F3N6O4S and a molecular weight of 422.39 g/mol. Its IUPAC name is N-hydroxy-4-[3-(methanesulfonamido)propylamino]-N'-[3-(trifluoromethyl)phenyl]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N-hydroxy-4-[3-(methanesulfonamido)propylamino]-N'-[3-(trifluoromethyl)phenyl]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 135895391 |
| Molecular Formula | C14H17F3N6O4S |
| Molecular Weight | 422.39 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | N-hydroxy-4-[3-(methanesulfonamido)propylamino]-N'-[3-(trifluoromethyl)phenyl]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CS(=O)(=O)NCCCNc1nonc1/C(=N/c1cccc(C(F)(F)F)c1)NO |
| InChI | InChI=1S/C14H17F3N6O4S/c1-28(25,26)19-7-3-6-18-12-11(22-27-23-12)13(21-24)20-10-5-2-4-9(8-10)14(15,16)17/h2,4-5,8,19,24H,3,6-7H2,1H3,(H,18,23)(H,20,21) |
| InChIKey | NQNWGOYDURQABD-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 141.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.39 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|