C15H12FN3O5S — CID 135895707
5-[[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]iminomethyl]-1-(4-fluorophenyl)-6-hydroxypyrimidine-2,4-dione (PubChem CID 135895707) has the molecular formula C15H12FN3O5S and a molecular weight of 365.34 g/mol. Its IUPAC name is 5-[[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]iminomethyl]-1-(4-fluorophenyl)-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 5-[[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]iminomethyl]-1-(4-fluorophenyl)-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135895707 |
| Molecular Formula | C15H12FN3O5S |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | 5-[[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]iminomethyl]-1-(4-fluorophenyl)-6-hydroxypyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(-c2ccc(F)cc2)c(O)c1/C=N/[C@@H]1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C15H12FN3O5S/c16-9-1-3-11(4-2-9)19-14(21)12(13(20)18-15(19)22)7-17-10-5-6-25(23,24)8-10/h1-7,10,21H,8H2,(H,18,20,22)/b17-7+/t10-/m1/s1 |
| InChIKey | WKVMXVSDTIZOJT-LZUJDIRXSA-N |
| XLogP | 0.10 |
| TPSA | 121.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|