C19H22ClN3O6 — CID 135895725
(3R)-3-(4-chlorophenyl)-4-[[6-hydroxy-1-(3-methoxypropyl)-2,4-dioxopyrimidin-5-yl]methylideneamino]butanoic acid (PubChem CID 135895725) has the molecular formula C19H22ClN3O6 and a molecular weight of 423.85 g/mol. Its IUPAC name is (3R)-3-(4-chlorophenyl)-4-[[6-hydroxy-1-(3-methoxypropyl)-2,4-dioxopyrimidin-5-yl]methylideneamino]butanoic acid.
| Compound Name | (3R)-3-(4-chlorophenyl)-4-[[6-hydroxy-1-(3-methoxypropyl)-2,4-dioxopyrimidin-5-yl]methylideneamino]butanoic acid |
|---|---|
| PubChem CID | 135895725 |
| Molecular Formula | C19H22ClN3O6 |
| Molecular Weight | 423.85 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | (3R)-3-(4-chlorophenyl)-4-[[6-hydroxy-1-(3-methoxypropyl)-2,4-dioxopyrimidin-5-yl]methylideneamino]butanoic acid |
| SMILES | COCCCn1c(O)c(/C=N/C[C@H](CC(=O)O)c2ccc(Cl)cc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H22ClN3O6/c1-29-8-2-7-23-18(27)15(17(26)22-19(23)28)11-21-10-13(9-16(24)25)12-3-5-14(20)6-4-12/h3-6,11,13,27H,2,7-10H2,1H3,(H,24,25)(H,22,26,28)/b21-11+/t13-/m0/s1 |
| InChIKey | CNNYIFIGKDNCIK-PUFAJPFRSA-N |
| XLogP | 1.61 |
| TPSA | 133.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.85 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|