C17H16N4O — CID 135896041
(3R,4S)-4-[(1S)-cyclohex-3-en-1-yl]-2-oxo-3,4-dihydro-1H-pyrimido[1,2-a]benzimidazole-3-carbonitrile (PubChem CID 135896041) has the molecular formula C17H16N4O and a molecular weight of 292.34 g/mol. Its IUPAC name is (3R,4S)-4-[(1S)-cyclohex-3-en-1-yl]-2-oxo-3,4-dihydro-1H-pyrimido[1,2-a]benzimidazole-3-carbonitrile.
| Compound Name | (3R,4S)-4-[(1S)-cyclohex-3-en-1-yl]-2-oxo-3,4-dihydro-1H-pyrimido[1,2-a]benzimidazole-3-carbonitrile |
|---|---|
| PubChem CID | 135896041 |
| Molecular Formula | C17H16N4O |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | (3R,4S)-4-[(1S)-cyclohex-3-en-1-yl]-2-oxo-3,4-dihydro-1H-pyrimido[1,2-a]benzimidazole-3-carbonitrile |
| SMILES | N#C[C@@H]1C(=O)Nc2nc3ccccc3n2[C@H]1[C@@H]1CC=CCC1 |
| InChI | InChI=1S/C17H16N4O/c18-10-12-15(11-6-2-1-3-7-11)21-14-9-5-4-8-13(14)19-17(21)20-16(12)22/h1-2,4-5,8-9,11-12,15H,3,6-7H2,(H,19,20,22)/t11-,12+,15+/m1/s1 |
| InChIKey | IZICIDBAFGBQMG-XUJVJEKNSA-N |
| XLogP | 3.03 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|