About 2-[(7-hydroxy-3,6-diphenylquinoline-8-carbonyl)amino]acetic acid
2-[(7-hydroxy-3,6-diphenylquinoline-8-carbonyl)amino]acetic acid (PubChem CID 135896331) has the molecular formula C24H18N2O4
and a molecular weight of 398.42 g/mol. Its IUPAC name is 2-[(7-hydroxy-3,6-diphenylquinoline-8-carbonyl)amino]acetic acid.
Molecular Properties
| Compound Name | 2-[(7-hydroxy-3,6-diphenylquinoline-8-carbonyl)amino]acetic acid |
| PubChem CID | 135896331 |
| Molecular Formula | C24H18N2O4 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 2-[(7-hydroxy-3,6-diphenylquinoline-8-carbonyl)amino]acetic acid |
| SMILES | O=C(O)CNC(=O)c1c(O)c(-c2ccccc2)cc2cc(-c3ccccc3)cnc12 |
| InChI | InChI=1S/C24H18N2O4/c27-20(28)14-26-24(30)21-22-17(11-18(13-25-22)15-7-3-1-4-8-15)12-19(23(21)29)16-9-5-2-6-10-16/h1-13,29H,14H2,(H,26,30)(H,27,28) |
| InChIKey | CAXVKRHNQQNMSU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(7-hydroxy-3,6-diphenylquinoline-8-carbonyl)amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(7-hydroxy-3,6-diphenylquinoline-8-carbonyl)amino]acetic acid?
The IUPAC name of 2-[(7-hydroxy-3,6-diphenylquinoline-8-carbonyl)amino]acetic acid (CID 135896331) is 2-[(7-hydroxy-3,6-diphenylquinoline-8-carbonyl)amino]acetic acid.
What is the SMILES notation for 2-[(7-hydroxy-3,6-diphenylquinoline-8-carbonyl)amino]acetic acid?
The canonical SMILES for 2-[(7-hydroxy-3,6-diphenylquinoline-8-carbonyl)amino]acetic acid is O=C(O)CNC(=O)c1c(O)c(-c2ccccc2)cc2cc(-c3ccccc3)cnc12.
What is the InChIKey of 2-[(7-hydroxy-3,6-diphenylquinoline-8-carbonyl)amino]acetic acid?
The InChIKey is CAXVKRHNQQNMSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18N2O4/c27-20(28)14-26-24(30)21-22-17(11-18(13-25-22)15-7-3-1-4-8-15)12-19(23(21)29)16-9-5-2-6-10-16/h1-13,29H,14H2,(H,26,30)(H,27,28).
What are the key properties of 2-[(7-hydroxy-3,6-diphenylquinoline-8-carbonyl)amino]acetic acid?
2-[(7-hydroxy-3,6-diphenylquinoline-8-carbonyl)amino]acetic acid has a molecular weight of 398.42 g/mol, XLogP of 4.09, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(7-hydroxy-3,6-diphenylquinoline-8-carbonyl)amino]acetic acid is sourced from PubChem (CID 135896331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).