C25H27N3O3S2 — CID 135896777
1-butyl-5-[2-(4-ethoxyphenyl)-2,3-dihydro-1,5-benzothiazepin-4-yl]-6-hydroxy-2-sulfanylidenepyrimidin-4-one (PubChem CID 135896777) has the molecular formula C25H27N3O3S2 and a molecular weight of 481.64 g/mol. Its IUPAC name is 1-butyl-5-[2-(4-ethoxyphenyl)-2,3-dihydro-1,5-benzothiazepin-4-yl]-6-hydroxy-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 1-butyl-5-[2-(4-ethoxyphenyl)-2,3-dihydro-1,5-benzothiazepin-4-yl]-6-hydroxy-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 135896777 |
| Molecular Formula | C25H27N3O3S2 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | 1-butyl-5-[2-(4-ethoxyphenyl)-2,3-dihydro-1,5-benzothiazepin-4-yl]-6-hydroxy-2-sulfanylidenepyrimidin-4-one |
| SMILES | CCCCn1c(O)c(C2=Nc3ccccc3SC(c3ccc(OCC)cc3)C2)c(=O)[nH]c1=S |
| InChI | InChI=1S/C25H27N3O3S2/c1-3-5-14-28-24(30)22(23(29)27-25(28)32)19-15-21(16-10-12-17(13-11-16)31-4-2)33-20-9-7-6-8-18(20)26-19/h6-13,21,30H,3-5,14-15H2,1-2H3,(H,27,29,32) |
| InChIKey | YWIKMGVZKFLNNJ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|