About ethyl 1-[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]piperidine-4-carboxylate
ethyl 1-[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]piperidine-4-carboxylate (PubChem CID 135896948) has the molecular formula C16H23N3O4
and a molecular weight of 321.38 g/mol. Its IUPAC name is ethyl 1-[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]piperidine-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]piperidine-4-carboxylate |
| PubChem CID | 135896948 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | ethyl 1-[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)Cc2c(C)nc(C)[nH]c2=O)CC1 |
| InChI | InChI=1S/C16H23N3O4/c1-4-23-16(22)12-5-7-19(8-6-12)14(20)9-13-10(2)17-11(3)18-15(13)21/h12H,4-9H2,1-3H3,(H,17,18,21) |
| InChIKey | ITNVISSVPLXTQV-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 92.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 1-[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]piperidine-4-carboxylate?
The IUPAC name of ethyl 1-[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]piperidine-4-carboxylate (CID 135896948) is ethyl 1-[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]piperidine-4-carboxylate.
What is the SMILES notation for ethyl 1-[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]piperidine-4-carboxylate?
The canonical SMILES for ethyl 1-[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]piperidine-4-carboxylate is CCOC(=O)C1CCN(C(=O)Cc2c(C)nc(C)[nH]c2=O)CC1.
What is the InChIKey of ethyl 1-[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]piperidine-4-carboxylate?
The InChIKey is ITNVISSVPLXTQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3O4/c1-4-23-16(22)12-5-7-19(8-6-12)14(20)9-13-10(2)17-11(3)18-15(13)21/h12H,4-9H2,1-3H3,(H,17,18,21).
What are the key properties of ethyl 1-[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]piperidine-4-carboxylate?
ethyl 1-[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]piperidine-4-carboxylate has a molecular weight of 321.38 g/mol, XLogP of 0.73, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]piperidine-4-carboxylate is sourced from PubChem (CID 135896948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).