C15H24N4O3 — CID 135896980
2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)-N-(3-morpholin-4-ylpropyl)acetamide (PubChem CID 135896980) has the molecular formula C15H24N4O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is 2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)-N-(3-morpholin-4-ylpropyl)acetamide.
| Compound Name | 2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)-N-(3-morpholin-4-ylpropyl)acetamide |
|---|---|
| PubChem CID | 135896980 |
| Molecular Formula | C15H24N4O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)-N-(3-morpholin-4-ylpropyl)acetamide |
| SMILES | Cc1nc(C)c(CC(=O)NCCCN2CCOCC2)c(=O)[nH]1 |
| InChI | InChI=1S/C15H24N4O3/c1-11-13(15(21)18-12(2)17-11)10-14(20)16-4-3-5-19-6-8-22-9-7-19/h3-10H2,1-2H3,(H,16,20)(H,17,18,21) |
| InChIKey | NHKIRKJXSBECJC-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|