C6H10N4O4 — CID 135897357
(NE)-N-[(2Z,4E,5Z)-2,4,5-tris(hydroxyimino)hexan-3-ylidene]hydroxylamine (PubChem CID 135897357) has the molecular formula C6H10N4O4 and a molecular weight of 202.17 g/mol. Its IUPAC name is (NE)-N-[(2Z,4E,5Z)-2,4,5-tris(hydroxyimino)hexan-3-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[(2Z,4E,5Z)-2,4,5-tris(hydroxyimino)hexan-3-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 135897357 |
| Molecular Formula | C6H10N4O4 |
| Molecular Weight | 202.17 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | (NE)-N-[(2Z,4E,5Z)-2,4,5-tris(hydroxyimino)hexan-3-ylidene]hydroxylamine |
| SMILES | C/C(=N/O)C(=NO)C(=N/O)/C(C)=N\O |
| InChI | InChI=1S/C6H10N4O4/c1-3(7-11)5(9-13)6(10-14)4(2)8-12/h11-14H,1-2H3/b7-3-,8-4-,9-5+,10-6+ |
| InChIKey | OXXDUKPWJDYWIP-HWAKKXLNSA-N |
| XLogP | 0.35 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.17 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|