C56H54N4O8 — CID 135897813
5,10,15,20-tetrakis[3-(2-methoxyethoxy)phenyl]-21,23-dihydroporphyrin (PubChem CID 135897813) has the molecular formula C56H54N4O8 and a molecular weight of 911.07 g/mol. Its IUPAC name is 5,10,15,20-tetrakis[3-(2-methoxyethoxy)phenyl]-21,23-dihydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis[3-(2-methoxyethoxy)phenyl]-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135897813 |
| Molecular Formula | C56H54N4O8 |
| Molecular Weight | 911.07 g/mol |
| Exact Mass | 910.39 |
| IUPAC Name | 5,10,15,20-tetrakis[3-(2-methoxyethoxy)phenyl]-21,23-dihydroporphyrin |
| SMILES | COCCOc1cccc(-c2c3nc(c(-c4cccc(OCCOC)c4)c4ccc([nH]4)c(-c4cccc(OCCOC)c4)c4nc(c(-c5cccc(OCCOC)c5)c5ccc2[nH]5)C=C4)C=C3)c1 |
| InChI | InChI=1S/C56H54N4O8/c1-61-25-29-65-41-13-5-9-37(33-41)53-45-17-19-47(57-45)54(38-10-6-14-42(34-38)66-30-26-62-2)49-21-23-51(59-49)56(40-12-8-16-44(36-40)68-32-28-64-4)52-24-22-50(60-52)55(48-20-18-46(53)58-48)39-11-7-15-43(35-39)67-31-27-63-3/h5-24,33-36,57,60H,25-32H2,1-4H3/b53-45-,53-46-,54-47-,54-49-,55-48-,55-50-,56-51-,56-52- |
| InChIKey | VXORSVYSLBQLNZ-YFLSTINXSA-N |
| XLogP | 11.42 |
| TPSA | 131.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 911.07 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|