C52H46N4O8 — CID 135897829
2-[4-[10,15,20-tris[4-(2-hydroxyethoxy)phenyl]-21,23-dihydroporphyrin-5-yl]phenoxy]ethanol (PubChem CID 135897829) has the molecular formula C52H46N4O8 and a molecular weight of 854.96 g/mol. Its IUPAC name is 2-[4-[10,15,20-tris[4-(2-hydroxyethoxy)phenyl]-21,23-dihydroporphyrin-5-yl]phenoxy]ethanol.
| Compound Name | 2-[4-[10,15,20-tris[4-(2-hydroxyethoxy)phenyl]-21,23-dihydroporphyrin-5-yl]phenoxy]ethanol |
|---|---|
| PubChem CID | 135897829 |
| Molecular Formula | C52H46N4O8 |
| Molecular Weight | 854.96 g/mol |
| Exact Mass | 854.33 |
| IUPAC Name | 2-[4-[10,15,20-tris[4-(2-hydroxyethoxy)phenyl]-21,23-dihydroporphyrin-5-yl]phenoxy]ethanol |
| SMILES | OCCOc1ccc(-c2c3nc(c(-c4ccc(OCCO)cc4)c4ccc([nH]4)c(-c4ccc(OCCO)cc4)c4nc(c(-c5ccc(OCCO)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C52H46N4O8/c57-25-29-61-37-9-1-33(2-10-37)49-41-17-19-43(53-41)50(34-3-11-38(12-4-34)62-30-26-58)45-21-23-47(55-45)52(36-7-15-40(16-8-36)64-32-28-60)48-24-22-46(56-48)51(44-20-18-42(49)54-44)35-5-13-39(14-6-35)63-31-27-59/h1-24,53,56-60H,25-32H2/b49-41-,49-42-,50-43-,50-45-,51-44-,51-46-,52-47-,52-48- |
| InChIKey | BQLHKVZEPBPQOJ-RCOMQYLTSA-N |
| XLogP | 8.81 |
| TPSA | 175.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.96 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |