C56H38F16N4O8 — CID 135897830
5,10,15,20-tetrakis[2,3,5,6-tetrafluoro-4-(2-methoxyethoxy)phenyl]-21,23-dihydroporphyrin (PubChem CID 135897830) has the molecular formula C56H38F16N4O8 and a molecular weight of 1198.91 g/mol. Its IUPAC name is 5,10,15,20-tetrakis[2,3,5,6-tetrafluoro-4-(2-methoxyethoxy)phenyl]-21,23-dihydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis[2,3,5,6-tetrafluoro-4-(2-methoxyethoxy)phenyl]-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135897830 |
| Molecular Formula | C56H38F16N4O8 |
| Molecular Weight | 1198.91 g/mol |
| Exact Mass | 1198.24 |
| IUPAC Name | 5,10,15,20-tetrakis[2,3,5,6-tetrafluoro-4-(2-methoxyethoxy)phenyl]-21,23-dihydroporphyrin |
| SMILES | COCCOc1c(F)c(F)c(-c2c3nc(c(-c4c(F)c(F)c(OCCOC)c(F)c4F)c4ccc([nH]4)c(-c4c(F)c(F)c(OCCOC)c(F)c4F)c4nc(c(-c5c(F)c(F)c(OCCOC)c(F)c5F)c5ccc2[nH]5)C=C4)C=C3)c(F)c1F |
| InChI | InChI=1S/C56H38F16N4O8/c1-77-13-17-81-53-45(65)37(57)33(38(58)46(53)66)29-21-5-7-23(73-21)30(34-39(59)47(67)54(48(68)40(34)60)82-18-14-78-2)25-9-11-27(75-25)32(36-43(63)51(71)56(52(72)44(36)64)84-20-16-80-4)28-12-10-26(76-28)31(24-8-6-22(29)74-24)35-41(61)49(69)55(50(70)42(35)62)83-19-15-79-3/h5-12,73,76H,13-20H2,1-4H3/b29-21+,29-22+,30-23+,30-25+,31-24+,31-26+,32-27+,32-28+ |
| InChIKey | UYHGFSCWOCOVBY-QQZXBORTSA-N |
| XLogP | 13.65 |
| TPSA | 131.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1198.91 |
| LogP ≤ 5 | 13.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|