C22H24BrClN4O4 — CID 135897900
3-[2-[(E)-[2-(6-bromo-2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino]oxyethyl-methylamino]propane-1,2-diol;hydrochloride (PubChem CID 135897900) has the molecular formula C22H24BrClN4O4 and a molecular weight of 523.82 g/mol. Its IUPAC name is 3-[2-[(E)-[2-(6-bromo-2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino]oxyethyl-methylamino]propane-1,2-diol;hydrochloride.
| Compound Name | 3-[2-[(E)-[2-(6-bromo-2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino]oxyethyl-methylamino]propane-1,2-diol;hydrochloride |
|---|---|
| PubChem CID | 135897900 |
| Molecular Formula | C22H24BrClN4O4 |
| Molecular Weight | 523.82 g/mol |
| Exact Mass | 522.07 |
| IUPAC Name | 3-[2-[(E)-[2-(6-bromo-2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino]oxyethyl-methylamino]propane-1,2-diol;hydrochloride |
| SMILES | CN(CCO/N=C1/C(c2c(O)[nH]c3cc(Br)ccc23)=Nc2ccccc21)CC(O)CO.Cl |
| InChI | InChI=1S/C22H23BrN4O4.ClH/c1-27(11-14(29)12-28)8-9-31-26-20-16-4-2-3-5-17(16)24-21(20)19-15-7-6-13(23)10-18(15)25-22(19)30;/h2-7,10,14,25,28-30H,8-9,11-12H2,1H3;1H/b26-20+; |
| InChIKey | BQQJMFRPTQCPPT-ZFUDNRMFSA-N |
| XLogP | 3.20 |
| TPSA | 113.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.82 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_imine_A(9)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|