C17H16N4O2 — CID 135898398
(4S)-5'-methyl-1'-prop-2-enylspiro[5,7-dihydro-1H-pyrazolo[5,4-b]pyridine-4,3'-indole]-2',6-dione (PubChem CID 135898398) has the molecular formula C17H16N4O2 and a molecular weight of 308.34 g/mol. Its IUPAC name is (4S)-5'-methyl-1'-prop-2-enylspiro[5,7-dihydro-1H-pyrazolo[5,4-b]pyridine-4,3'-indole]-2',6-dione.
| Compound Name | (4S)-5'-methyl-1'-prop-2-enylspiro[5,7-dihydro-1H-pyrazolo[5,4-b]pyridine-4,3'-indole]-2',6-dione |
|---|---|
| PubChem CID | 135898398 |
| Molecular Formula | C17H16N4O2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | (4S)-5'-methyl-1'-prop-2-enylspiro[5,7-dihydro-1H-pyrazolo[5,4-b]pyridine-4,3'-indole]-2',6-dione |
| SMILES | C=CCN1C(=O)[C@@]2(CC(=O)Nc3[nH]ncc32)c2cc(C)ccc21 |
| InChI | InChI=1S/C17H16N4O2/c1-3-6-21-13-5-4-10(2)7-11(13)17(16(21)23)8-14(22)19-15-12(17)9-18-20-15/h3-5,7,9H,1,6,8H2,2H3,(H2,18,19,20,22)/t17-/m0/s1 |
| InChIKey | NIGWYANNIOEKQZ-KRWDZBQOSA-N |
| XLogP | 1.88 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|