C15H24N6 — CID 135898799
N-cyclopentyl-4-cyclopentylimino-2,3-dihydro-1H-imidazo[1,5-d][1,2,4]triazin-1-amine (PubChem CID 135898799) has the molecular formula C15H24N6 and a molecular weight of 288.40 g/mol. Its IUPAC name is N-cyclopentyl-4-cyclopentylimino-2,3-dihydro-1H-imidazo[1,5-d][1,2,4]triazin-1-amine.
| Compound Name | N-cyclopentyl-4-cyclopentylimino-2,3-dihydro-1H-imidazo[1,5-d][1,2,4]triazin-1-amine |
|---|---|
| PubChem CID | 135898799 |
| Molecular Formula | C15H24N6 |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | N-cyclopentyl-4-cyclopentylimino-2,3-dihydro-1H-imidazo[1,5-d][1,2,4]triazin-1-amine |
| SMILES | c1ncn2c1C(NC1CCCC1)NN/C2=N\C1CCCC1 |
| InChI | InChI=1S/C15H24N6/c1-2-6-11(5-1)17-14-13-9-16-10-21(13)15(20-19-14)18-12-7-3-4-8-12/h9-12,14,17,19H,1-8H2,(H,18,20) |
| InChIKey | PHUXRCZXIUAHOS-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 66.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|