About 2,4-diamino-1H-pyrimidin-6-one;hydrate
2,4-diamino-1H-pyrimidin-6-one;hydrate (PubChem CID 135898821) has the molecular formula C4H8N4O2
and a molecular weight of 144.13 g/mol. Its IUPAC name is 2,4-diamino-1H-pyrimidin-6-one;hydrate.
Molecular Properties
| Compound Name | 2,4-diamino-1H-pyrimidin-6-one;hydrate |
| PubChem CID | 135898821 |
| Molecular Formula | C4H8N4O2 |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.06 |
| IUPAC Name | 2,4-diamino-1H-pyrimidin-6-one;hydrate |
| SMILES | Nc1cc(=O)[nH]c(N)n1.O |
| InChI | InChI=1S/C4H6N4O.H2O/c5-2-1-3(9)8-4(6)7-2;/h1H,(H5,5,6,7,8,9);1H2 |
| InChIKey | FGLKDSMCITXHSK-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 129.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,4-diamino-1H-pyrimidin-6-one;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diamino-1H-pyrimidin-6-one;hydrate?
The IUPAC name of 2,4-diamino-1H-pyrimidin-6-one;hydrate (CID 135898821) is 2,4-diamino-1H-pyrimidin-6-one;hydrate.
What is the SMILES notation for 2,4-diamino-1H-pyrimidin-6-one;hydrate?
The canonical SMILES for 2,4-diamino-1H-pyrimidin-6-one;hydrate is Nc1cc(=O)[nH]c(N)n1.O.
What is the InChIKey of 2,4-diamino-1H-pyrimidin-6-one;hydrate?
The InChIKey is FGLKDSMCITXHSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N4O.H2O/c5-2-1-3(9)8-4(6)7-2;/h1H,(H5,5,6,7,8,9);1H2.
What are the key properties of 2,4-diamino-1H-pyrimidin-6-one;hydrate?
2,4-diamino-1H-pyrimidin-6-one;hydrate has a molecular weight of 144.13 g/mol, XLogP of -1.89, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diamino-1H-pyrimidin-6-one;hydrate is sourced from PubChem (CID 135898821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).