C15H10ClF2N3S — CID 135898828
N-(3-chlorophenyl)-5-(3,4-difluorophenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 135898828) has the molecular formula C15H10ClF2N3S and a molecular weight of 337.78 g/mol. Its IUPAC name is N-(3-chlorophenyl)-5-(3,4-difluorophenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | N-(3-chlorophenyl)-5-(3,4-difluorophenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 135898828 |
| Molecular Formula | C15H10ClF2N3S |
| Molecular Weight | 337.78 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | N-(3-chlorophenyl)-5-(3,4-difluorophenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | Fc1ccc(C2=NN/C(=N/c3cccc(Cl)c3)SC2)cc1F |
| InChI | InChI=1S/C15H10ClF2N3S/c16-10-2-1-3-11(7-10)19-15-21-20-14(8-22-15)9-4-5-12(17)13(18)6-9/h1-7H,8H2,(H,19,21) |
| InChIKey | DPTVRUOMHYCSDX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.78 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|