C9H10N4O3 — CID 135899066
9-(3-oxobutyl)-1,7-dihydropurine-6,8-dione (PubChem CID 135899066) has the molecular formula C9H10N4O3 and a molecular weight of 222.20 g/mol. Its IUPAC name is 9-(3-oxobutyl)-1,7-dihydropurine-6,8-dione.
| Compound Name | 9-(3-oxobutyl)-1,7-dihydropurine-6,8-dione |
|---|---|
| PubChem CID | 135899066 |
| Molecular Formula | C9H10N4O3 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 9-(3-oxobutyl)-1,7-dihydropurine-6,8-dione |
| SMILES | CC(=O)CCn1c(=O)[nH]c2c(=O)[nH]cnc21 |
| InChI | InChI=1S/C9H10N4O3/c1-5(14)2-3-13-7-6(12-9(13)16)8(15)11-4-10-7/h4H,2-3H2,1H3,(H,12,16)(H,10,11,15) |
| InChIKey | VRZUMXVEBDYPIV-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 100.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |