About 2-[2-(4-chlorophenyl)ethoxymethyl]-3H-pyrido[2,3-d]pyrimidin-4-one
2-[2-(4-chlorophenyl)ethoxymethyl]-3H-pyrido[2,3-d]pyrimidin-4-one (PubChem CID 135899108) has the molecular formula C16H14ClN3O2
and a molecular weight of 315.76 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)ethoxymethyl]-3H-pyrido[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-[2-(4-chlorophenyl)ethoxymethyl]-3H-pyrido[2,3-d]pyrimidin-4-one |
| PubChem CID | 135899108 |
| Molecular Formula | C16H14ClN3O2 |
| Molecular Weight | 315.76 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 2-[2-(4-chlorophenyl)ethoxymethyl]-3H-pyrido[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(COCCc2ccc(Cl)cc2)nc2ncccc12 |
| InChI | InChI=1S/C16H14ClN3O2/c17-12-5-3-11(4-6-12)7-9-22-10-14-19-15-13(16(21)20-14)2-1-8-18-15/h1-6,8H,7,9-10H2,(H,18,19,20,21) |
| InChIKey | CKSXJJBTFDAELX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.76 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(4-chlorophenyl)ethoxymethyl]-3H-pyrido[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(4-chlorophenyl)ethoxymethyl]-3H-pyrido[2,3-d]pyrimidin-4-one?
The IUPAC name of 2-[2-(4-chlorophenyl)ethoxymethyl]-3H-pyrido[2,3-d]pyrimidin-4-one (CID 135899108) is 2-[2-(4-chlorophenyl)ethoxymethyl]-3H-pyrido[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 2-[2-(4-chlorophenyl)ethoxymethyl]-3H-pyrido[2,3-d]pyrimidin-4-one?
The canonical SMILES for 2-[2-(4-chlorophenyl)ethoxymethyl]-3H-pyrido[2,3-d]pyrimidin-4-one is O=c1[nH]c(COCCc2ccc(Cl)cc2)nc2ncccc12.
What is the InChIKey of 2-[2-(4-chlorophenyl)ethoxymethyl]-3H-pyrido[2,3-d]pyrimidin-4-one?
The InChIKey is CKSXJJBTFDAELX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14ClN3O2/c17-12-5-3-11(4-6-12)7-9-22-10-14-19-15-13(16(21)20-14)2-1-8-18-15/h1-6,8H,7,9-10H2,(H,18,19,20,21).
What are the key properties of 2-[2-(4-chlorophenyl)ethoxymethyl]-3H-pyrido[2,3-d]pyrimidin-4-one?
2-[2-(4-chlorophenyl)ethoxymethyl]-3H-pyrido[2,3-d]pyrimidin-4-one has a molecular weight of 315.76 g/mol, XLogP of 2.73, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4-chlorophenyl)ethoxymethyl]-3H-pyrido[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 135899108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).