About N-[(4-oxo-3H-pyrido[2,3-d]pyrimidin-2-yl)methyl]-3-phenylpropanamide
N-[(4-oxo-3H-pyrido[2,3-d]pyrimidin-2-yl)methyl]-3-phenylpropanamide (PubChem CID 135899280) has the molecular formula C17H16N4O2
and a molecular weight of 308.34 g/mol. Its IUPAC name is N-[(4-oxo-3H-pyrido[2,3-d]pyrimidin-2-yl)methyl]-3-phenylpropanamide.
Molecular Properties
| Compound Name | N-[(4-oxo-3H-pyrido[2,3-d]pyrimidin-2-yl)methyl]-3-phenylpropanamide |
| PubChem CID | 135899280 |
| Molecular Formula | C17H16N4O2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | N-[(4-oxo-3H-pyrido[2,3-d]pyrimidin-2-yl)methyl]-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)NCc1nc2ncccc2c(=O)[nH]1 |
| InChI | InChI=1S/C17H16N4O2/c22-15(9-8-12-5-2-1-3-6-12)19-11-14-20-16-13(17(23)21-14)7-4-10-18-16/h1-7,10H,8-9,11H2,(H,19,22)(H,18,20,21,23) |
| InChIKey | PKQOVHPVASDOMA-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(4-oxo-3H-pyrido[2,3-d]pyrimidin-2-yl)methyl]-3-phenylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-oxo-3H-pyrido[2,3-d]pyrimidin-2-yl)methyl]-3-phenylpropanamide?
The IUPAC name of N-[(4-oxo-3H-pyrido[2,3-d]pyrimidin-2-yl)methyl]-3-phenylpropanamide (CID 135899280) is N-[(4-oxo-3H-pyrido[2,3-d]pyrimidin-2-yl)methyl]-3-phenylpropanamide.
What is the SMILES notation for N-[(4-oxo-3H-pyrido[2,3-d]pyrimidin-2-yl)methyl]-3-phenylpropanamide?
The canonical SMILES for N-[(4-oxo-3H-pyrido[2,3-d]pyrimidin-2-yl)methyl]-3-phenylpropanamide is O=C(CCc1ccccc1)NCc1nc2ncccc2c(=O)[nH]1.
What is the InChIKey of N-[(4-oxo-3H-pyrido[2,3-d]pyrimidin-2-yl)methyl]-3-phenylpropanamide?
The InChIKey is PKQOVHPVASDOMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N4O2/c22-15(9-8-12-5-2-1-3-6-12)19-11-14-20-16-13(17(23)21-14)7-4-10-18-16/h1-7,10H,8-9,11H2,(H,19,22)(H,18,20,21,23).
What are the key properties of N-[(4-oxo-3H-pyrido[2,3-d]pyrimidin-2-yl)methyl]-3-phenylpropanamide?
N-[(4-oxo-3H-pyrido[2,3-d]pyrimidin-2-yl)methyl]-3-phenylpropanamide has a molecular weight of 308.34 g/mol, XLogP of 1.57, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-oxo-3H-pyrido[2,3-d]pyrimidin-2-yl)methyl]-3-phenylpropanamide is sourced from PubChem (CID 135899280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).