C16H15N3O4 — CID 135899627
N-[(Z)-1-(4-hydroxyphenyl)propylideneamino]-2-nitrobenzamide (PubChem CID 135899627) has the molecular formula C16H15N3O4 and a molecular weight of 313.31 g/mol. Its IUPAC name is N-[(Z)-1-(4-hydroxyphenyl)propylideneamino]-2-nitrobenzamide.
| Compound Name | N-[(Z)-1-(4-hydroxyphenyl)propylideneamino]-2-nitrobenzamide |
|---|---|
| PubChem CID | 135899627 |
| Molecular Formula | C16H15N3O4 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | N-[(Z)-1-(4-hydroxyphenyl)propylideneamino]-2-nitrobenzamide |
| SMILES | CC/C(=N/NC(=O)c1ccccc1[N+](=O)[O-])c1ccc(O)cc1 |
| InChI | InChI=1S/C16H15N3O4/c1-2-14(11-7-9-12(20)10-8-11)17-18-16(21)13-5-3-4-6-15(13)19(22)23/h3-10,20H,2H2,1H3,(H,18,21)/b17-14- |
| InChIKey | ZAEQEBUQFHJOIG-VKAVYKQESA-N |
| XLogP | 2.84 |
| TPSA | 104.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|