C13H14F4N4O3 — CID 135900076
6-(difluoromethyl)-1-(5,5-difluoropentyl)-3-methyl-7H-pyrimido[5,4-d]pyrimidine-2,4,8-trione (PubChem CID 135900076) has the molecular formula C13H14F4N4O3 and a molecular weight of 350.27 g/mol. Its IUPAC name is 6-(difluoromethyl)-1-(5,5-difluoropentyl)-3-methyl-7H-pyrimido[5,4-d]pyrimidine-2,4,8-trione.
| Compound Name | 6-(difluoromethyl)-1-(5,5-difluoropentyl)-3-methyl-7H-pyrimido[5,4-d]pyrimidine-2,4,8-trione |
|---|---|
| PubChem CID | 135900076 |
| Molecular Formula | C13H14F4N4O3 |
| Molecular Weight | 350.27 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 6-(difluoromethyl)-1-(5,5-difluoropentyl)-3-methyl-7H-pyrimido[5,4-d]pyrimidine-2,4,8-trione |
| SMILES | Cn1c(=O)c2nc(C(F)F)[nH]c(=O)c2n(CCCCC(F)F)c1=O |
| InChI | InChI=1S/C13H14F4N4O3/c1-20-12(23)7-8(11(22)19-10(18-7)9(16)17)21(13(20)24)5-3-2-4-6(14)15/h6,9H,2-5H2,1H3,(H,18,19,22) |
| InChIKey | YGDPONLEPAJVBL-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 89.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.27 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|