C14H18F2N4O3 — CID 135900081
6-(difluoromethyl)-1-hexyl-3-methyl-7H-pyrimido[5,4-d]pyrimidine-2,4,8-trione (PubChem CID 135900081) has the molecular formula C14H18F2N4O3 and a molecular weight of 328.32 g/mol. Its IUPAC name is 6-(difluoromethyl)-1-hexyl-3-methyl-7H-pyrimido[5,4-d]pyrimidine-2,4,8-trione.
| Compound Name | 6-(difluoromethyl)-1-hexyl-3-methyl-7H-pyrimido[5,4-d]pyrimidine-2,4,8-trione |
|---|---|
| PubChem CID | 135900081 |
| Molecular Formula | C14H18F2N4O3 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 6-(difluoromethyl)-1-hexyl-3-methyl-7H-pyrimido[5,4-d]pyrimidine-2,4,8-trione |
| SMILES | CCCCCCn1c(=O)n(C)c(=O)c2nc(C(F)F)[nH]c(=O)c21 |
| InChI | InChI=1S/C14H18F2N4O3/c1-3-4-5-6-7-20-9-8(13(22)19(2)14(20)23)17-11(10(15)16)18-12(9)21/h10H,3-7H2,1-2H3,(H,17,18,21) |
| InChIKey | JSUHWBVPIPRVNW-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 89.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|