C24H22N4O — CID 135900352
8-methyl-5-phenyl-3-phenyldiazenyl-1,6,7,9-tetrahydropyrrolo[3,2-h]isoquinolin-2-ol (PubChem CID 135900352) has the molecular formula C24H22N4O and a molecular weight of 382.47 g/mol. Its IUPAC name is 8-methyl-5-phenyl-3-phenyldiazenyl-1,6,7,9-tetrahydropyrrolo[3,2-h]isoquinolin-2-ol.
| Compound Name | 8-methyl-5-phenyl-3-phenyldiazenyl-1,6,7,9-tetrahydropyrrolo[3,2-h]isoquinolin-2-ol |
|---|---|
| PubChem CID | 135900352 |
| Molecular Formula | C24H22N4O |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 8-methyl-5-phenyl-3-phenyldiazenyl-1,6,7,9-tetrahydropyrrolo[3,2-h]isoquinolin-2-ol |
| SMILES | CN1CCc2c(-c3ccccc3)cc3c(/N=N/c4ccccc4)c(O)[nH]c3c2C1 |
| InChI | InChI=1S/C24H22N4O/c1-28-13-12-18-19(16-8-4-2-5-9-16)14-20-22(21(18)15-28)25-24(29)23(20)27-26-17-10-6-3-7-11-17/h2-11,14,25,29H,12-13,15H2,1H3/b27-26+ |
| InChIKey | VPJPILBZQCKQSM-CYYJNZCTSA-N |
| XLogP | 5.94 |
| TPSA | 63.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|