About 4-(1-benzofuran-2-yl)-8-phenylmethoxy-2,5-dihydropyridazino[4,5-b]indol-1-one
4-(1-benzofuran-2-yl)-8-phenylmethoxy-2,5-dihydropyridazino[4,5-b]indol-1-one (PubChem CID 135900475) has the molecular formula C25H17N3O3
and a molecular weight of 407.43 g/mol. Its IUPAC name is 4-(1-benzofuran-2-yl)-8-phenylmethoxy-2,5-dihydropyridazino[4,5-b]indol-1-one.
Molecular Properties
| Compound Name | 4-(1-benzofuran-2-yl)-8-phenylmethoxy-2,5-dihydropyridazino[4,5-b]indol-1-one |
| PubChem CID | 135900475 |
| Molecular Formula | C25H17N3O3 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 4-(1-benzofuran-2-yl)-8-phenylmethoxy-2,5-dihydropyridazino[4,5-b]indol-1-one |
| SMILES | O=c1[nH]nc(-c2cc3ccccc3o2)c2[nH]c3ccc(OCc4ccccc4)cc3c12 |
| InChI | InChI=1S/C25H17N3O3/c29-25-22-18-13-17(30-14-15-6-2-1-3-7-15)10-11-19(18)26-24(22)23(27-28-25)21-12-16-8-4-5-9-20(16)31-21/h1-13,26H,14H2,(H,28,29) |
| InChIKey | ARXTVVRHJRBFBI-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(1-benzofuran-2-yl)-8-phenylmethoxy-2,5-dihydropyridazino[4,5-b]indol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-benzofuran-2-yl)-8-phenylmethoxy-2,5-dihydropyridazino[4,5-b]indol-1-one?
The IUPAC name of 4-(1-benzofuran-2-yl)-8-phenylmethoxy-2,5-dihydropyridazino[4,5-b]indol-1-one (CID 135900475) is 4-(1-benzofuran-2-yl)-8-phenylmethoxy-2,5-dihydropyridazino[4,5-b]indol-1-one.
What is the SMILES notation for 4-(1-benzofuran-2-yl)-8-phenylmethoxy-2,5-dihydropyridazino[4,5-b]indol-1-one?
The canonical SMILES for 4-(1-benzofuran-2-yl)-8-phenylmethoxy-2,5-dihydropyridazino[4,5-b]indol-1-one is O=c1[nH]nc(-c2cc3ccccc3o2)c2[nH]c3ccc(OCc4ccccc4)cc3c12.
What is the InChIKey of 4-(1-benzofuran-2-yl)-8-phenylmethoxy-2,5-dihydropyridazino[4,5-b]indol-1-one?
The InChIKey is ARXTVVRHJRBFBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H17N3O3/c29-25-22-18-13-17(30-14-15-6-2-1-3-7-15)10-11-19(18)26-24(22)23(27-28-25)21-12-16-8-4-5-9-20(16)31-21/h1-13,26H,14H2,(H,28,29).
What are the key properties of 4-(1-benzofuran-2-yl)-8-phenylmethoxy-2,5-dihydropyridazino[4,5-b]indol-1-one?
4-(1-benzofuran-2-yl)-8-phenylmethoxy-2,5-dihydropyridazino[4,5-b]indol-1-one has a molecular weight of 407.43 g/mol, XLogP of 5.40, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-benzofuran-2-yl)-8-phenylmethoxy-2,5-dihydropyridazino[4,5-b]indol-1-one is sourced from PubChem (CID 135900475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).