C20H15BrN2O3 — CID 135901315
2-[(5R,10bS)-9-bromo-5-(furan-2-yl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-2-yl]phenol (PubChem CID 135901315) has the molecular formula C20H15BrN2O3 and a molecular weight of 411.26 g/mol. Its IUPAC name is 2-[(5R,10bS)-9-bromo-5-(furan-2-yl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-2-yl]phenol.
| Compound Name | 2-[(5R,10bS)-9-bromo-5-(furan-2-yl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-2-yl]phenol |
|---|---|
| PubChem CID | 135901315 |
| Molecular Formula | C20H15BrN2O3 |
| Molecular Weight | 411.26 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | 2-[(5R,10bS)-9-bromo-5-(furan-2-yl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-2-yl]phenol |
| SMILES | Oc1ccccc1C1=NN2[C@@H](c3ccco3)Oc3ccc(Br)cc3[C@@H]2C1 |
| InChI | InChI=1S/C20H15BrN2O3/c21-12-7-8-18-14(10-12)16-11-15(13-4-1-2-5-17(13)24)22-23(16)20(26-18)19-6-3-9-25-19/h1-10,16,20,24H,11H2/t16-,20+/m0/s1 |
| InChIKey | WPPRXYCTQGAEQO-OXJNMPFZSA-N |
| XLogP | 4.99 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.26 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'} |
|---|