C23H23N5O4 — CID 135902301
butyl 4-[[2-[(6S)-5-oxo-2-phenyl-4,6-dihydroimidazo[1,2-b][1,2,4]triazol-6-yl]acetyl]amino]benzoate (PubChem CID 135902301) has the molecular formula C23H23N5O4 and a molecular weight of 433.47 g/mol. Its IUPAC name is butyl 4-[[2-[(6S)-5-oxo-2-phenyl-4,6-dihydroimidazo[1,2-b][1,2,4]triazol-6-yl]acetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-[(6S)-5-oxo-2-phenyl-4,6-dihydroimidazo[1,2-b][1,2,4]triazol-6-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 135902301 |
| Molecular Formula | C23H23N5O4 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | butyl 4-[[2-[(6S)-5-oxo-2-phenyl-4,6-dihydroimidazo[1,2-b][1,2,4]triazol-6-yl]acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)C[C@H]2C(=O)Nc3nc(-c4ccccc4)nn32)cc1 |
| InChI | InChI=1S/C23H23N5O4/c1-2-3-13-32-22(31)16-9-11-17(12-10-16)24-19(29)14-18-21(30)26-23-25-20(27-28(18)23)15-7-5-4-6-8-15/h4-12,18H,2-3,13-14H2,1H3,(H,24,29)(H,25,26,27,30)/t18-/m0/s1 |
| InChIKey | LUKPCZNJYLNKND-SFHVURJKSA-N |
| XLogP | 3.42 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|