C18H16ClN5O4 — CID 135903375
5-[(13R)-15-amino-4,8-dioxa-12,14,16,18-tetrazatetracyclo[9.7.0.03,9.012,17]octadeca-1,3(9),10,14,17-pentaen-13-yl]-3-chlorobenzene-1,2-diol (PubChem CID 135903375) has the molecular formula C18H16ClN5O4 and a molecular weight of 401.81 g/mol. Its IUPAC name is 5-[(13R)-15-amino-4,8-dioxa-12,14,16,18-tetrazatetracyclo[9.7.0.03,9.012,17]octadeca-1,3(9),10,14,17-pentaen-13-yl]-3-chlorobenzene-1,2-diol.
| Compound Name | 5-[(13R)-15-amino-4,8-dioxa-12,14,16,18-tetrazatetracyclo[9.7.0.03,9.012,17]octadeca-1,3(9),10,14,17-pentaen-13-yl]-3-chlorobenzene-1,2-diol |
|---|---|
| PubChem CID | 135903375 |
| Molecular Formula | C18H16ClN5O4 |
| Molecular Weight | 401.81 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 5-[(13R)-15-amino-4,8-dioxa-12,14,16,18-tetrazatetracyclo[9.7.0.03,9.012,17]octadeca-1,3(9),10,14,17-pentaen-13-yl]-3-chlorobenzene-1,2-diol |
| SMILES | NC1=N[C@@H](c2cc(O)c(O)c(Cl)c2)n2c(nc3cc4c(cc32)OCCCO4)N1 |
| InChI | InChI=1S/C18H16ClN5O4/c19-9-4-8(5-12(25)15(9)26)16-22-17(20)23-18-21-10-6-13-14(7-11(10)24(16)18)28-3-1-2-27-13/h4-7,16,25-26H,1-3H2,(H3,20,21,22,23)/t16-/m1/s1 |
| InChIKey | KGKIWMBOHOKQJW-MRXNPFEDSA-N |
| XLogP | 2.55 |
| TPSA | 127.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.81 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|