C14H11N3O2 — CID 135904333
2-methoxy-5-phenyl-3H-pyrido[2,3-d]pyrimidin-4-one (PubChem CID 135904333) has the molecular formula C14H11N3O2 and a molecular weight of 253.26 g/mol. Its IUPAC name is 2-methoxy-5-phenyl-3H-pyrido[2,3-d]pyrimidin-4-one.
| Compound Name | 2-methoxy-5-phenyl-3H-pyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135904333 |
| Molecular Formula | C14H11N3O2 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 2-methoxy-5-phenyl-3H-pyrido[2,3-d]pyrimidin-4-one |
| SMILES | COc1nc2nccc(-c3ccccc3)c2c(=O)[nH]1 |
| InChI | InChI=1S/C14H11N3O2/c1-19-14-16-12-11(13(18)17-14)10(7-8-15-12)9-5-3-2-4-6-9/h2-8H,1H3,(H,15,16,17,18) |
| InChIKey | GTNJAYDBQMMXAH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |