C22H26N4O3S — CID 135904714
methyl 2-[[(6R,9R)-6-methyl-8-oxo-9-(4-propan-2-ylphenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-2-yl]sulfanyl]acetate (PubChem CID 135904714) has the molecular formula C22H26N4O3S and a molecular weight of 426.54 g/mol. Its IUPAC name is methyl 2-[[(6R,9R)-6-methyl-8-oxo-9-(4-propan-2-ylphenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-2-yl]sulfanyl]acetate.
| Compound Name | methyl 2-[[(6R,9R)-6-methyl-8-oxo-9-(4-propan-2-ylphenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 135904714 |
| Molecular Formula | C22H26N4O3S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | methyl 2-[[(6R,9R)-6-methyl-8-oxo-9-(4-propan-2-ylphenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-2-yl]sulfanyl]acetate |
| SMILES | COC(=O)CSc1nc2n(n1)[C@H](c1ccc(C(C)C)cc1)C1=C(C[C@@H](C)CC1=O)N2 |
| InChI | InChI=1S/C22H26N4O3S/c1-12(2)14-5-7-15(8-6-14)20-19-16(9-13(3)10-17(19)27)23-21-24-22(25-26(20)21)30-11-18(28)29-4/h5-8,12-13,20H,9-11H2,1-4H3,(H,23,24,25)/t13-,20-/m1/s1 |
| InChIKey | JDTCOQGBKJLNKV-ZUOKHONESA-N |
| XLogP | 3.93 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |