C20H17N5O4 — CID 135904755
(6R,9S)-6-(furan-2-yl)-2-methyl-9-(4-nitrophenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135904755) has the molecular formula C20H17N5O4 and a molecular weight of 391.39 g/mol. Its IUPAC name is (6R,9S)-6-(furan-2-yl)-2-methyl-9-(4-nitrophenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | (6R,9S)-6-(furan-2-yl)-2-methyl-9-(4-nitrophenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135904755 |
| Molecular Formula | C20H17N5O4 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | (6R,9S)-6-(furan-2-yl)-2-methyl-9-(4-nitrophenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | Cc1nc2n(n1)[C@@H](c1ccc([N+](=O)[O-])cc1)C1=C(C[C@@H](c3ccco3)CC1=O)N2 |
| InChI | InChI=1S/C20H17N5O4/c1-11-21-20-22-15-9-13(17-3-2-8-29-17)10-16(26)18(15)19(24(20)23-11)12-4-6-14(7-5-12)25(27)28/h2-8,13,19H,9-10H2,1H3,(H,21,22,23)/t13-,19+/m1/s1 |
| InChIKey | CDCRZEFVPPZHRS-YJYMSZOUSA-N |
| XLogP | 3.50 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|