C27H22N4O3 — CID 135905087
N-[(2Z,4E)-1-[(2-hydroxy-5-methyl-1H-indol-3-yl)diazenyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide (PubChem CID 135905087) has the molecular formula C27H22N4O3 and a molecular weight of 450.50 g/mol. Its IUPAC name is N-[(2Z,4E)-1-[(2-hydroxy-5-methyl-1H-indol-3-yl)diazenyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide.
| Compound Name | N-[(2Z,4E)-1-[(2-hydroxy-5-methyl-1H-indol-3-yl)diazenyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide |
|---|---|
| PubChem CID | 135905087 |
| Molecular Formula | C27H22N4O3 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | N-[(2Z,4E)-1-[(2-hydroxy-5-methyl-1H-indol-3-yl)diazenyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide |
| SMILES | Cc1ccc2[nH]c(O)c(/N=N/C(=O)/C(=C/C=C/c3ccccc3)NC(=O)c3ccccc3)c2c1 |
| InChI | InChI=1S/C27H22N4O3/c1-18-15-16-22-21(17-18)24(27(34)28-22)30-31-26(33)23(14-8-11-19-9-4-2-5-10-19)29-25(32)20-12-6-3-7-13-20/h2-17,28,34H,1H3,(H,29,32)/b11-8+,23-14-,31-30+ |
| InChIKey | PBIAEKMLZGGLDY-SDFSUXFOSA-N |
| XLogP | 5.82 |
| TPSA | 106.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|