C26H28F3N5O3 — CID 135905451
[4-[(5S,7R)-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]phenyl]-piperazin-1-ylmethanone (PubChem CID 135905451) has the molecular formula C26H28F3N5O3 and a molecular weight of 515.54 g/mol. Its IUPAC name is [4-[(5S,7R)-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]phenyl]-piperazin-1-ylmethanone.
| Compound Name | [4-[(5S,7R)-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]phenyl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 135905451 |
| Molecular Formula | C26H28F3N5O3 |
| Molecular Weight | 515.54 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | [4-[(5S,7R)-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]phenyl]-piperazin-1-ylmethanone |
| SMILES | COc1ccc([C@@H]2C[C@H](C(F)(F)F)n3nc(-c4ccc(C(=O)N5CCNCC5)cc4)cc3N2)cc1OC |
| InChI | InChI=1S/C26H28F3N5O3/c1-36-21-8-7-18(13-22(21)37-2)19-14-23(26(27,28)29)34-24(31-19)15-20(32-34)16-3-5-17(6-4-16)25(35)33-11-9-30-10-12-33/h3-8,13,15,19,23,30-31H,9-12,14H2,1-2H3/t19-,23+/m0/s1 |
| InChIKey | YBAJVMDZJITCEZ-WMZHIEFXSA-N |
| XLogP | 4.27 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.54 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |