C31H28N2O — CID 135905957
2-[[(4R,10S)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]iminomethyl]phenol (PubChem CID 135905957) has the molecular formula C31H28N2O and a molecular weight of 444.58 g/mol. Its IUPAC name is 2-[[(4R,10S)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]iminomethyl]phenol.
| Compound Name | 2-[[(4R,10S)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135905957 |
| Molecular Formula | C31H28N2O |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 2-[[(4R,10S)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]iminomethyl]phenol |
| SMILES | Oc1ccccc1/C=N/c1cc2c3c(c1)[C@H](c1ccccc1)CCN3CC[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C31H28N2O/c34-30-14-8-7-13-24(30)21-32-25-19-28-26(22-9-3-1-4-10-22)15-17-33-18-16-27(29(20-25)31(28)33)23-11-5-2-6-12-23/h1-14,19-21,26-27,34H,15-18H2/b32-21+/t26-,27+ |
| InChIKey | BRGJIRDEULZHNL-RVLHIEJWSA-N |
| XLogP | 7.02 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|