About 5-butyl-2-[3-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]-4-methyl-1H-pyrimidin-6-one
5-butyl-2-[3-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]-4-methyl-1H-pyrimidin-6-one (PubChem CID 135906350) has the molecular formula C21H27F2N3O
and a molecular weight of 375.46 g/mol. Its IUPAC name is 5-butyl-2-[3-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]-4-methyl-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 5-butyl-2-[3-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]-4-methyl-1H-pyrimidin-6-one |
| PubChem CID | 135906350 |
| Molecular Formula | C21H27F2N3O |
| Molecular Weight | 375.46 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | 5-butyl-2-[3-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]-4-methyl-1H-pyrimidin-6-one |
| SMILES | CCCCc1c(C)nc(-c2cccc(CN3CCC(F)(F)CC3)c2)[nH]c1=O |
| InChI | InChI=1S/C21H27F2N3O/c1-3-4-8-18-15(2)24-19(25-20(18)27)17-7-5-6-16(13-17)14-26-11-9-21(22,23)10-12-26/h5-7,13H,3-4,8-12,14H2,1-2H3,(H,24,25,27) |
| InChIKey | HWJUYSWAOQXMLI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.46 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-butyl-2-[3-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]-4-methyl-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butyl-2-[3-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]-4-methyl-1H-pyrimidin-6-one?
The IUPAC name of 5-butyl-2-[3-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]-4-methyl-1H-pyrimidin-6-one (CID 135906350) is 5-butyl-2-[3-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]-4-methyl-1H-pyrimidin-6-one.
What is the SMILES notation for 5-butyl-2-[3-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]-4-methyl-1H-pyrimidin-6-one?
The canonical SMILES for 5-butyl-2-[3-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]-4-methyl-1H-pyrimidin-6-one is CCCCc1c(C)nc(-c2cccc(CN3CCC(F)(F)CC3)c2)[nH]c1=O.
What is the InChIKey of 5-butyl-2-[3-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]-4-methyl-1H-pyrimidin-6-one?
The InChIKey is HWJUYSWAOQXMLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27F2N3O/c1-3-4-8-18-15(2)24-19(25-20(18)27)17-7-5-6-16(13-17)14-26-11-9-21(22,23)10-12-26/h5-7,13H,3-4,8-12,14H2,1-2H3,(H,24,25,27).
What are the key properties of 5-butyl-2-[3-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]-4-methyl-1H-pyrimidin-6-one?
5-butyl-2-[3-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]-4-methyl-1H-pyrimidin-6-one has a molecular weight of 375.46 g/mol, XLogP of 4.32, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butyl-2-[3-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]-4-methyl-1H-pyrimidin-6-one is sourced from PubChem (CID 135906350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).