C33H40N4O4 — CID 135906464
methyl 2-[2-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentylimino]-3-(4-phenylphenyl)-1,4-dihydroquinazolin-4-yl]acetate (PubChem CID 135906464) has the molecular formula C33H40N4O4 and a molecular weight of 556.71 g/mol. Its IUPAC name is methyl 2-[2-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentylimino]-3-(4-phenylphenyl)-1,4-dihydroquinazolin-4-yl]acetate.
| Compound Name | methyl 2-[2-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentylimino]-3-(4-phenylphenyl)-1,4-dihydroquinazolin-4-yl]acetate |
|---|---|
| PubChem CID | 135906464 |
| Molecular Formula | C33H40N4O4 |
| Molecular Weight | 556.71 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | methyl 2-[2-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentylimino]-3-(4-phenylphenyl)-1,4-dihydroquinazolin-4-yl]acetate |
| SMILES | COC(=O)CC1c2ccccc2N/C(=N\CCCCCNC(=O)OC(C)(C)C)N1c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C33H40N4O4/c1-33(2,3)41-32(39)35-22-12-6-11-21-34-31-36-28-16-10-9-15-27(28)29(23-30(38)40-4)37(31)26-19-17-25(18-20-26)24-13-7-5-8-14-24/h5,7-10,13-20,29H,6,11-12,21-23H2,1-4H3,(H,34,36)(H,35,39) |
| InChIKey | PDYGWPOBXZQADF-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.71 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|