C16H16Br2N4OS — CID 135906476
2-[3-[(3,5-dibromophenyl)methylamino]propylamino]-3H-thieno[3,2-d]pyrimidin-4-one (PubChem CID 135906476) has the molecular formula C16H16Br2N4OS and a molecular weight of 472.21 g/mol. Its IUPAC name is 2-[3-[(3,5-dibromophenyl)methylamino]propylamino]-3H-thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 2-[3-[(3,5-dibromophenyl)methylamino]propylamino]-3H-thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135906476 |
| Molecular Formula | C16H16Br2N4OS |
| Molecular Weight | 472.21 g/mol |
| Exact Mass | 469.94 |
| IUPAC Name | 2-[3-[(3,5-dibromophenyl)methylamino]propylamino]-3H-thieno[3,2-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(NCCCNCc2cc(Br)cc(Br)c2)nc2ccsc12 |
| InChI | InChI=1S/C16H16Br2N4OS/c17-11-6-10(7-12(18)8-11)9-19-3-1-4-20-16-21-13-2-5-24-14(13)15(23)22-16/h2,5-8,19H,1,3-4,9H2,(H2,20,21,22,23) |
| InChIKey | HMWUEOQAHKJQTK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.21 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|