C13H11N5S2 — CID 135906655
14-ethylsulfanyl-2-thia-9,12,13,15,16-pentazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3,5,7,11,13,16-heptaene (PubChem CID 135906655) has the molecular formula C13H11N5S2 and a molecular weight of 301.40 g/mol. Its IUPAC name is 14-ethylsulfanyl-2-thia-9,12,13,15,16-pentazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3,5,7,11,13,16-heptaene.
| Compound Name | 14-ethylsulfanyl-2-thia-9,12,13,15,16-pentazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3,5,7,11,13,16-heptaene |
|---|---|
| PubChem CID | 135906655 |
| Molecular Formula | C13H11N5S2 |
| Molecular Weight | 301.40 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 14-ethylsulfanyl-2-thia-9,12,13,15,16-pentazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3,5,7,11,13,16-heptaene |
| SMILES | CCSc1nnc2c3c(cnn12)Sc1ccccc1N3 |
| InChI | InChI=1S/C13H11N5S2/c1-2-19-13-17-16-12-11-10(7-14-18(12)13)20-9-6-4-3-5-8(9)15-11/h3-7,15H,2H2,1H3 |
| InChIKey | DXDQSLAJAOBUGM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |